A1595250
(5,10,15,20-Tetraphenylporphinato)manganese(III)chloride , 95% , 32195-55-4
Synonym(s):
meso-Tetraphenylporphyrin manganese(III) chloride complex;meso-Tetraphenylporphyrin manganese(III)-chloride complex
CAS NO.:32195-55-4
Empirical Formula: C44H28ClMnN4
Molecular Weight: 703.11
MDL number: MFCD00012153
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB136.80 | In Stock |
|
| 1g | RMB456.80 | In Stock |
|
| 5g | RMB1668.80 | In Stock |
|
| 25g | RMB5599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >320 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder |
| color | Brown to black |
| λmax | 475 nm 583 nm (2nd) |
| BRN | 5699425 |
| InChIKey | MIUMWNDEIWVIEG-YKKPBKTHSA-M |
| SMILES | N12[Mn](Cl)N3C4C=CC3=C(C3C=CC(N=3)=C(C3=CC=CC=C3)C1=CC=C2C(C1=CC=CC=C1)=C1C=CC(C=4C2=CC=CC=C2)=N1)C1=CC=CC=C1 |c:8,15,42,t:37| |
Description and Uses
Tetraphenylporphyrin manganese (III) chloride complex generally finds application in determining histidine in aqueous solutions by resonance light scattering technique.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






