A1603012
2-Bromo-1-indanol , >98.0%(GC) , 5400-80-6
CAS NO.：5400-80-6
Empirical Formula: C9H9BrO
Molecular Weight: 213.07
MDL number: MFCD00003798
EINECS: 226-442-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB102.96 | In Stock |
|
| 25G | RMB361.60 | In Stock |
|
| 50g | RMB799.20 | In Stock |
|
| 250g | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129-132 °C(lit.) |
| Boiling point: | 247.5°C (rough estimate) |
| Density | 1.3841 (rough estimate) |
| refractive index | 1.5720 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 13.19±0.40(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| BRN | 2046877 |
| InChI | InChI=1S/C9H9BrO/c10-8-5-6-3-1-2-4-7(6)9(8)11/h1-4,8-9,11H,5H2 |
| InChIKey | RTESDSDXFLYAKZ-UHFFFAOYSA-N |
| SMILES | C1(O)C2=C(C=CC=C2)CC1Br |
| CAS DataBase Reference | 5400-80-6(CAS DataBase Reference) |
Description and Uses
2-Bromo-1-indanol is a bicyclic alcohol with antiviral properties.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29062900 |
