A1604712
4-Bromo-2-fluorophenol , >98.0%(GC) , 2105-94-4
CAS NO.:2105-94-4
Empirical Formula: C6H4BrFO
Molecular Weight: 191
MDL number: MFCD00011722
EINECS: 218-284-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB59.20 | In Stock |
|
| 100G | RMB211.20 | In Stock |
|
| 500g | RMB944.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 79 °C/7 mmHg (lit.) |
| Density | 1.744 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 210 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 8.14±0.18(Predicted) |
| form | Liquid |
| Specific Gravity | 1.744 |
| color | Clear colorless to brown |
| BRN | 1861281 |
| InChI | InChI=1S/C6H4BrFO/c7-4-1-2-6(9)5(8)3-4/h1-3,9H |
| InChIKey | RYVOZMPTISNBDB-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(Br)C=C1F |
| CAS DataBase Reference | 2105-94-4(CAS DataBase Reference) |
Description and Uses
4-Bromo-2-fluorophenol can be used as a starting material for the synthesis of:
- 4-Bromo-2-fluoro-6-iodoanisole via iodination and methylation.
- 2-Phenylpyran-4-ones for active cyclooxygenase-2 inhibitor evaluation.
- 1,4-Disubstituted 3-cyano-2-pyridones.
- Dicationic imidazolium-based compounds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-37/39-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29071990 |
| Storage Class | 10 - Combustible liquids |






