A1663912
3-[1,1′-Biphenyl]-4-yl-2-propenoic acid , 95% , 13026-23-8
CAS NO.:13026-23-8
Empirical Formula: C15H12O2
Molecular Weight: 224.25
MDL number: MFCD00014010
EINECS: 235-888-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB46.40 | In Stock |
|
| 5g | RMB138.40 | In Stock |
|
| 25g | RMB624.00 | In Stock |
|
| 50g | RMB1240.00 | In Stock |
|
| 100g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 224-225°C |
| Boiling point: | 412.9±24.0 °C(Predicted) |
| Density | 1.178±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder |
| pka | 4.46±0.10(Predicted) |
| color | White |
| Water Solubility | Slightly soluble in water. |
| BRN | 1955124 |
| InChI | 1S/C15H12O2/c16-15(17)11-8-12-6-9-14(10-7-12)13-4-2-1-3-5-13/h1-11H,(H,16,17)/b11-8+ |
| InChIKey | DMJDEZUEYXVYNO-DHZHZOJOSA-N |
| SMILES | OC(=O)\C=C\c1ccc(cc1)c2ccccc2 |
| CAS DataBase Reference | 13026-23-8(CAS DataBase Reference) |
Description and Uses
4-Phenylcinnamic acid is used as pharmaceutical intermediates and for chemical research.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H319-H411 |
| Precautionary statements | P273-P301+P312+P330-P305+P351+P338 |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 22-51/53 |
| Safety Statements | 22-24/25-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 |

![3-[1,1′-Biphenyl]-4-yl-2-propenoic acid](https://img.chemicalbook.com/CAS/GIF/13026-23-8.gif)




