A1670012
2-<WBR>Bromo-<WBR>1,4-<WBR>dichlorobenzene , 97% , 1435-50-3
CAS NO.：1435-50-3
Empirical Formula: C6H3BrCl2
Molecular Weight: 225.9
MDL number: MFCD00018505
EINECS: 215-859-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.80 | In Stock |
|
| 5G | RMB48.80 | In Stock |
|
| 25G | RMB94.40 | In Stock |
|
| 100g | RMB369.60 | In Stock |
|
| 500g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 32-36 °C(lit.) |
| Boiling point: | 118-120°C 20mm |
| Density | 1.6351 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light orange to Yellow |
| Water Solubility | insoluble |
| BRN | 1934815 |
| InChI | InChI=1S/C6H3BrCl2/c7-5-3-4(8)1-2-6(5)9/h1-3H |
| InChIKey | OVXVQBCRONSPDC-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(Cl)C=C1Br |
| CAS DataBase Reference | 1435-50-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 2-bromo-1,4-dichloro-(1435-50-3) |
| EPA Substance Registry System | Benzene, 2-bromo-1,4-dichloro- (1435-50-3) |
Description and Uses
2-Bromo-1,4-dichlorobenzene is a reactant used in the synthesis of C-13 and C-14-labeled versions of the investigational proteasome inhibitor MLN9708.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-28A |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
