A1673312
5-<WBR>Bromo-<WBR>4-<WBR>chloro-<WBR>3-<WBR>indolyl β-<SC>D</SC>-glucopyranoside , 97% , 15548-60-4
Synonym(s):
X-Glc;X-glucoside
CAS NO.:15548-60-4
Empirical Formula: C14H15BrClNO6
Molecular Weight: 408.63
MDL number: MFCD00063690
EINECS: 239-603-0
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB47.20 | In Stock |
|
| 25MG | RMB79.20 | In Stock |
|
| 100MG | RMB159.20 | In Stock |
|
| 500mg | RMB447.20 | In Stock |
|
| 2.5g | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 249-251 °C |
| alpha | -81 º (c=1, DMF) |
| Boiling point: | 673.9±55.0 °C(Predicted) |
| Density | 1.882±0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | DMF: 50 mg/mL, clear, colorless to very faintly yellow |
| form | Crystalline powder |
| pka | 12.74±0.70(Predicted) |
| color | White to Light yellow |
| BRN | 1552603 |
| InChI | InChI=1/C14H15BrClNO6/c15-5-1-2-6-9(10(5)16)7(3-17-6)22-14-13(21)12(20)11(19)8(4-18)23-14/h1-3,8,11-14,17-21H,4H2/t8-,11-,12+,13-,14-/s3 |
| InChIKey | OPIFSICVWOWJMJ-OTXFOCTGSA-N |
| SMILES | C12C(Cl)=C(C=CC=1NC=C2O[C@H]1[C@H](O)[C@H]([C@H](O)[C@@H](CO)O1)O)Br |&1:11,12,14,15,17,r| |
| CAS DataBase Reference | 15548-60-4(CAS DataBase Reference) |
Description and Uses
Substrate for beta-D-glucosidase
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 8-10-21 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |




![5-Bromo-4-chloro-3-indolyl β-<small>D</small>-Glucuronide Sodium Salt [for Biochemical Research]](https://img.chemicalbook.com/CAS/GIF/129541-41-9.gif)
