LN7735351
5-Bromo-4-chloro-3-indolyl-β-D-cellobioside , 98% , 177966-52-8
CAS NO.：177966-52-8
Empirical Formula: C20H25BrClNO11
Molecular Weight: 570.77
MDL number: MFCD00798387
EINECS: 634-018-0
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB993.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 869.7±65.0 °C(Predicted) |
| Density | 1.91±0.1 g/cm3(Predicted) |
| storage temp. | −20°C |
| form | crystalline powder |
| pka | 12.61±0.70(Predicted) |
| color | White |
| InChIKey | TXCDHJGGJYHESA-IQCPCBEINA-N |
| SMILES | C12C(Cl)=C(C=CC=1NC=C2O[C@H]1[C@H](O)[C@H]([C@H](O[C@H]2[C@H](O)[C@H]([C@H](O)[C@@H](CO)O2)O)[C@@H](CO)O1)O)Br |&1:11,12,14,15,17,18,20,21,23,28,r| |
Description and Uses
5-Bromo-4-chloro-3-indolyl β-D-cellobioside is a chromogenic compound used to detect cellobiohydrolases[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280-P271 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29389090 |
