A1715412
1-<WBR>Benzyloxy-<WBR>3-<WBR>methyl-<WBR>2-<WBR>nitrobenzene , 95% , 61535-21-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB207.20 | In Stock |
|
| 5G | RMB627.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 36 °C |
| Boiling point: | 150 °C/1.5 mmHg (lit.) |
| Density | 1.738 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| InChI | 1S/C14H13NO3/c1-11-6-5-9-13(14(11)15(16)17)18-10-12-7-3-2-4-8-12/h2-9H,10H2,1H3 |
| InChIKey | ZUMJNYJMXBJJIC-UHFFFAOYSA-N |
| SMILES | Cc1cccc(OCc2ccccc2)c1[N+]([O-])=O |
Description and Uses
1-Benzyloxy-3-methyl-2-nitrobenzene may be used in the multi-step preparation of 7-hydroxy-oxindole-3-acetic acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |






