A1937312
2-Bromo-3-hydroxybenzaldehyde , 98% , 196081-71-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB46.40 | In Stock |
|
| 5G | RMB153.60 | In Stock |
|
| 10g | RMB295.20 | In Stock |
|
| 25G | RMB584.80 | In Stock |
|
| 100G | RMB1959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147-148℃ |
| Boiling point: | 252℃ |
| Density | 1.737 |
| Flash point: | 106℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| pka | 7.71±0.10(Predicted) |
| color | Off-White to Pale Beige |
| InChI | InChI=1S/C7H5BrO2/c8-7-5(4-9)2-1-3-6(7)10/h1-4,10H |
| InChIKey | OHXPHMPERMIICA-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=CC(O)=C1Br |
Description and Uses
2-Bromo-3-hydroxybenzaldehyde is a reactant used in the preparation of a class of benzoxaboroles antimalarial agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| HS Code | 2913000090 |






![Methyl4-bromo-7-methoxybenzo[d][1,3]dioxole-5-carboxylate](https://img.chemicalbook.com/CAS/GIF/81474-46-6.gif)