PRODUCT Properties
| Boiling point: | 68°C/0.8mmHg(lit.) |
| Density | 1.415±0.06 g/cm3(Predicted) |
| refractive index | 1.5510 to 1.5550 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| pka | 2.17±0.10(Predicted) |
| color | Colorless to Light yellow |
| λmax | 268nm(EtOH)(lit.) |
| InChI | InChI=1S/C7H8BrN/c1-5-3-6(2)9-7(8)4-5/h3-4H,1-2H3 |
| InChIKey | IRTOCXBLUOPRFT-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC(C)=CC(C)=C1 |
| CAS DataBase Reference | 4926-26-5(CAS DataBase Reference) |
Description and Uses
2-Bromo-4,6-dimethylpyridine is a reactant in regioselective and diastereoselective syntheses of the natural product CCR5 antagonist anibamine and its three olefin isomers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| HS Code | 2933399990 |






