A2009512
5-Bromo-2-chloroaniline , 98% , 60811-17-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.80 | In Stock |
|
| 5G | RMB44.00 | In Stock |
|
| 10g | RMB85.60 | In Stock |
|
| 25G | RMB176.80 | In Stock |
|
| 100G | RMB585.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 48 °C |
| Boiling point: | 0°C |
| Density | 1.722±0.06 g/cm3(Predicted) |
| Flash point: | 0°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 1.58±0.10(Predicted) |
| form | Solid |
| Appearance | Light brown to brown Solid |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C6H5BrClN/c7-4-1-2-5(8)6(9)3-4/h1-3H,9H2 |
| InChIKey | UGOLEPGQWYPIBR-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(Br)=CC=C1Cl |
| CAS DataBase Reference | 60811-17-8(CAS DataBase Reference) |
Description and Uses
5-Bromo-2-chloroaniline is employed as a important raw material and intermediate used in organic synthesis agrochemical, pharmaceutical and dyestuff field.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H331-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| RIDADR | 2811 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29214990 |
