A2017312
4-Bromo-3-chlorotoluene , 98% , 6627-51-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB68.80 | In Stock |
|
| 100G | RMB359.20 | In Stock |
|
| 500g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 100 °C |
| Density | 1.54 |
| Flash point: | 106℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| color | Clear, faint yellow |
| Specific Gravity | 1.54 |
| InChI | InChI=1S/C7H6BrCl/c1-5-2-3-6(8)7(9)4-5/h2-4H,1H3 |
| InChIKey | SDTULEXOSNNGAW-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(C)C=C1Cl |
| CAS DataBase Reference | 6627-51-6(CAS DataBase Reference) |
Description and Uses
4-Bromo-3-chlorotoluene is a substrate for benzoate degradation and can be used to measure cell density. The substrate reacts with catechol to form benzyl alcohol and benzoic acid. The reaction depends on cell density and substrate concentration. 4-Bromo-3-chlorotoluene is also an analogue of benzoic acid in this reaction. This chemical reacts with Pseudomonas aeruginosa to produce toluene.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 36/37/38-51/53-22 |
| Safety Statements | 26-36/37/39-61 |
| RIDADR | UN2811 |
| HazardClass | IRRITANT |
| HS Code | 2903998090 |






