PRODUCT Properties
| Melting point: | -25.0--22.8 °C |
| Boiling point: | 193-194 °C(Press: 740 Torr) |
| Density | 1.717±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C7H3BrClF3/c8-5-2-1-4(3-6(5)9)7(10,11)12/h1-3H |
| InChIKey | RVTIHGGJJMXISV-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(C(F)(F)F)C=C1Cl |
Description and Uses
1-Bromo-2-chloro-4-trifluoromethylbenzene is a polysubstituted benzene derivative that can be used in the synthesis of NaV 1.7 inhibitor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 2903998090 |
