A2269012
4-Cyanophenylhydrazine hydrochloride , 97% , 2863-98-1
Synonym(s):
4-Hydrazinobenzonitrile hydrochloride
CAS NO.：2863-98-1
Empirical Formula: C7H8ClN3
Molecular Weight: 169.61
MDL number: MFCD00673994
EINECS: 608-230-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB53.60 | In Stock |
|
| 25G | RMB144.00 | In Stock |
|
| 100G | RMB492.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 241-244 °C (dec.)(lit.) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in methanol. |
| form | Powder |
| color | Pale orange to brown |
| Sensitive | Moisture Sensitive |
| BRN | 3565486 |
| InChI | InChI=1S/C7H7N3.ClH/c8-5-6-1-3-7(10-9)4-2-6;/h1-4,10H,9H2;1H |
| InChIKey | UXDLLFIRCVPPQP-UHFFFAOYSA-N |
| SMILES | C1(C#N)=CC=C(NN)C=C1.Cl |
| CAS DataBase Reference | 2863-98-1(CAS DataBase Reference) |
Description and Uses
4-Cyanophenylhydrazine Hydrochloride (cas# 2863-98-1) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-36/37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| PackingGroup | III |
| HS Code | 29280000 |
