A2270612
2-Chloro-5-fluoropyrimidine , 97% , 62802-42-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB96.00 | In Stock |
|
| 25G | RMB352.80 | In Stock |
|
| 100G | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 149.0-162.0°C |
| Density | 1.439 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point: | 150 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -2.54±0.22(Predicted) |
| form | Liquid |
| color | Clear colorless to yellow |
| InChI | InChI=1S/C4H2ClFN2/c5-4-7-1-3(6)2-8-4/h1-2H |
| InChIKey | AGYUQBNABXVWMS-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(F)C=N1 |
| CAS DataBase Reference | 62802-42-0(CAS DataBase Reference) |
Description and Uses
2-Chloro-5-fluoropyrimidine is used to prepare 2,4-disubstituted-5-fluoropyrimidine , which is a biologically active molecule seen in anticancer agents like 5-fluorouracil.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P270-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-34-41-37/38 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2735 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HazardClass | 8 |
| PackingGroup | Ⅲ |
| HS Code | 29335990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





