A2282912
2-Chlorophenothiazine , 98% , 92-39-7
Synonym(s):
2-Chlorothiodiphenylamine
CAS NO.：92-39-7
Empirical Formula: C12H8ClNS
Molecular Weight: 233.72
MDL number: MFCD00005016
EINECS: 202-152-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB48.00 | In Stock |
|
| 100G | RMB135.20 | In Stock |
|
| 500G | RMB552.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195-200 °C (lit.) |
| Boiling point: | 395.7±31.0 °C(Predicted) |
| Density | 1.2350 (rough estimate) |
| refractive index | 1.6100 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| pka | -2.28±0.20(Predicted) |
| form | crystals |
| color | Pale Beige to Beige |
| BRN | 176587 |
| InChI | InChI=1S/C12H8ClNS/c13-8-5-6-12-10(7-8)14-9-3-1-2-4-11(9)15-12/h1-7,14H |
| InChIKey | KFZGLJSYQXZIGP-UHFFFAOYSA-N |
| SMILES | C1=C2C(SC3=C(N2)C=CC=C3)=CC=C1Cl |
| LogP | 3.28 |
| CAS DataBase Reference | 92-39-7(CAS DataBase Reference) |
| EPA Substance Registry System | 10H-Phenothiazine, 2-chloro- (92-39-7) |
Description and Uses
2-Chlorophenothiazine may be used as starting reagent for the synthesis of N-(10H-phenothiazin-1-yl) benzene sulphonamide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P362+P364 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | SN7580000 |
| TSCA | Yes |
| HS Code | 2934300000 |
