A2308712
2-Chloro-5-nitrobenzaldehyde , 97% , 6361-21-3
CAS NO.:6361-21-3
Empirical Formula: C7H4ClNO3
Molecular Weight: 185.56
MDL number: MFCD00007293
EINECS: 228-830-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 10G | RMB42.40 | In Stock |
|
| 25G | RMB72.80 | In Stock |
|
| 50g | RMB111.20 | In Stock |
|
| 100G | RMB200.80 | In Stock |
|
| 500g | RMB767.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75-77 °C (lit.) |
| Boiling point: | 276.5°C (rough estimate) |
| Density | 1.4791 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Crystalline Powder |
| color | Pale yellow |
| Sensitive | Air Sensitive |
| BRN | 743764 |
| InChI | InChI=1S/C7H4ClNO3/c8-7-2-1-6(9(11)12)3-5(7)4-10/h1-4H |
| InChIKey | VFVHWCKUHAEDMY-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC([N+]([O-])=O)=CC=C1Cl |
| CAS DataBase Reference | 6361-21-3(CAS DataBase Reference) |
| EPA Substance Registry System | Benzaldehyde, 2-chloro-5-nitro- (6361-21-3) |
Description and Uses
2-Chloro-5-nitrobenzaldehyde was used in the synthesis of 5-nitro-2-(1H-pyrrol-1-yl)benzaldehyde.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H303-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26-36 |
| WGK Germany | 2 |
| RTECS | CU5220000 |
| F | 10 |
| Hazard Note | Irritant/Air Sensitive |
| TSCA | TSCA listed |
| HS Code | 29130000 |
| Storage Class | 11 - Combustible Solids |




