A2330412
N-Carbobenzyloxy-L-leucine , 96% , 2018-66-8
Synonym(s):
N-(Benzyloxycarbonyl)leucine;N-(Benzyloxycarbonyl)-L-leucine;N-(Carbobenzoxy)leucine;N-(Phenylmethoxy)carbonyl-L-leucine;N-Carbobenzoxy-L-leucine
CAS NO.:2018-66-8
Empirical Formula: C14H19NO4
Molecular Weight: 265.3
MDL number: MFCD00026494
EINECS: 217-960-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB115.20 | In Stock |
|
| 100G | RMB228.80 | In Stock |
|
| 500g | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | -17 º (c=2, ethanol) |
| Boiling point: | 408.52°C (rough estimate) |
| Density | 1 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 85 °F |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | viscous liquid |
| pka | 4.00±0.21(Predicted) |
| Specific Gravity | 1.0 |
| color | Colorless to Light yellow |
| optical activity | [α]20/D 17°, c = 2 in ethanol |
| Water Solubility | Not miscible or difficult to mix in water. Soluble in chloroform, DMSO and methanol. |
| BRN | 1253861 |
| Major Application | peptide synthesis |
| InChI | 1S/C14H19NO4/c1-10(2)8-12(13(16)17)15-14(18)19-9-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3,(H,15,18)(H,16,17)/t12-/m0/s1 |
| InChIKey | USPFMEKVPDBMCG-LBPRGKRZSA-N |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(O)=O |
| CAS DataBase Reference | 2018-66-8(CAS DataBase Reference) |
Description and Uses
Reactant for:
- Peptide-based preparation of potential antitumor agents
- Preparation of cyclopropyl peptidomimetics
- Peptide synthesis
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS08 |
| Signal word | Warning |
| Hazard statements | H226-H351-H361d |
| Precautionary statements | P210-P280-P370+P378 |
| Hazard Codes | Xn |
| Risk Statements | 10-20/22-37/38-40-41-36/37/38-20/21/22-67-63-19 |
| Safety Statements | 16-26-36/37/39-45-36-36/37-60 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| RTECS | OH2921000 |
| HS Code | 29242990 |








