A2339612
Clofentezine solution , analyticalstandard,100ug/mlinactone , 74115-24-5
Synonym(s):
3,6-Bis(2-chlorophenyl)-1,2,4,5-tetrazine;Clofentezine
CAS NO.:74115-24-5
Empirical Formula: C14H8Cl2N4
Molecular Weight: 303.15
MDL number: MFCD00143998
EINECS: 277-728-2
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB84.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 182-185 °C(lit.) |
| Boiling point: | 457.37°C (rough estimate) |
| Density | 1.3727 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| storage temp. | 0-6°C |
| solubility | Chloroform: Slightly Soluble |
| form | Solid |
| pka | -1.68±0.31(Predicted) |
| color | Light yellow to yellow |
| Water Solubility | 2.522ug/L(temperature not stated) |
| Merck | 13,2398 |
| BRN | 7137128 |
| Major Application | agriculture environmental |
| InChI | 1S/C14H8Cl2N4/c15-11-7-3-1-5-9(11)13-17-19-14(20-18-13)10-6-2-4-8-12(10)16/h1-8H |
| InChIKey | UXADOQPNKNTIHB-UHFFFAOYSA-N |
| SMILES | Clc1ccccc1-c2nnc(nn2)-c3ccccc3Cl |
| LogP | 3.100 |
| CAS DataBase Reference | 74115-24-5(CAS DataBase Reference) |
| EPA Substance Registry System | Clofentezine (74115-24-5) |
Description and Uses
Pesticide.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H312-H410 |
| Precautionary statements | P273-P280-P302+P352+P312-P362+P364-P391-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| RTECS | XF6860000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 1 |
| Toxicity | LD50 in rats, mice (mg/kg): >3200 orally; LC50 (96 hr) in rainbow trout: 100 mg/l (Bryan) |







