A2351112
(±)-Camphor-10-sulfonic acid , 99% , 5872-08-2
Synonym(s):
(±)-β-Camphorsulfonic acid;(±)-Camphor-10-sulfonic acid;CSA
CAS NO.:5872-08-2
Empirical Formula: C10H16O4S
Molecular Weight: 232.3
MDL number: MFCD00074827
EINECS: 227-527-0
| Pack Size | Price | Stock | Quantity |
| 25G | RMB47.20 | In Stock |
|
| 100G | RMB77.60 | In Stock |
|
| 500G | RMB270.40 | In Stock |
|
| 2.5KG | RMB1138.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 203-206 °C (dec.)(lit.) |
| alpha | [α]D20 0.0±0.3° (c=5, H2O) |
| Boiling point: | 344.46°C (rough estimate) |
| Density | 1.2981 (rough estimate) |
| refractive index | 1.5400 (estimate) |
| storage temp. | 2-8°C |
| form | Granular Powder |
| pka | 1.17±0.50(Predicted) |
| color | Slightly beige |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| BRN | 3205973 |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. Combustible. |
| Cosmetics Ingredients Functions | NOT REPORTED |
| InChI | 1S/C10H16O4S/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h7H,3-6H2,1-2H3,(H,12,13,14)/t7-,10-/m1/s1 |
| InChIKey | MIOPJNTWMNEORI-UHFFFAOYSA-N |
| SMILES | [H][C@@]12CC[C@@](CS(O)(=O)=O)(C(=O)C1)C2(C)C |
| CAS DataBase Reference | 5872-08-2(CAS DataBase Reference) |
| EPA Substance Registry System | Bicyclo[2.2.1]heptane-1-methanesulfonic acid, 7,7-dimethyl-2-oxo- (5872-08-2) |
Description and Uses
(+)-Camphor-10-sulfonic acid is used as a resolving agent for chiral amines and other cations. It is involved in the preparation of active pharmaceutical ingredient such as trimetaphan camsilate, which is used to reduce bleeding during neurosurgery. Further, it is involved in the transglucosidation of methyl and ethyl D-glucopyranosides by alcoholysis.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-27 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | DT5077100 |
| F | 3-10 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29147000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |






