A2367512
1-(4-Chlorophenyl)piperazine dihydrochloride , 95% , 38869-46-4
CAS NO.：38869-46-4
Empirical Formula: C10H15Cl3N2
Molecular Weight: 269.6
MDL number: MFCD00012766
EINECS: 254-165-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB84.80 | In Stock |
|
| 25G | RMB234.40 | In Stock |
|
| 100G | RMB778.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 275-278 °C (dec.)(lit.) |
| Boiling point: | 322.19°C (rough estimate) |
| Density | 1.1428 (rough estimate) |
| refractive index | 1.5749 (estimate) |
| storage temp. | Store at room temperature |
| form | powder |
| Appearance | White to off-white Solid |
| InChI | 1S/C10H13ClN2.2ClH/c11-9-1-3-10(4-2-9)13-7-5-12-6-8-13;;/h1-4,12H,5-8H2;2*1H |
| InChIKey | ORKOLISAYPZGHP-UHFFFAOYSA-N |
| SMILES | Cl[H].Cl[H].Clc1ccc(cc1)N2CCNCC2 |
| CAS DataBase Reference | 38869-46-4(CAS DataBase Reference) |
Description and Uses
5-HT2C/2B receptor agonist/partial agonist
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
