A2368212
N-(2-Cyanoethyl)-N-ethylaniline , 98% , 148-87-8
CAS NO.:148-87-8
Empirical Formula: C11H14N2
Molecular Weight: 174.24
MDL number: MFCD00019858
EINECS: 205-728-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB32.80 | In Stock |
|
| 100g | RMB107.20 | In Stock |
|
| 500G | RMB399.20 | In Stock |
|
| 2.5kg | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 137-140°C 4mm |
| Density | 1,03 g/cm3 |
| refractive index | 1.6210 (estimate) |
| storage temp. | Storage temp. 2-8°C |
| pka | 5.27±0.50(Predicted) |
| form | clear liquid |
| color | Colorless to Yellow |
| Specific Gravity | 1.03 |
| InChI | InChI=1S/C11H14N2/c1-2-13(10-6-9-12)11-7-4-3-5-8-11/h3-5,7-8H,2,6,10H2,1H3 |
| InChIKey | WYRNRZQRKCXPLA-UHFFFAOYSA-N |
| SMILES | C(#N)CCN(CC)C1=CC=CC=C1 |
| CAS DataBase Reference | 148-87-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Propionitrile, 3-(n-ethylanilino)-(148-87-8) |
| EPA Substance Registry System | Propanenitrile, 3-(ethylphenylamino)- (148-87-8) |
Description and Uses
3-(Ethylphenylamino)propanenitrile is a reagent used in the synthesis of mono-azo dyes for nylon and polyester fibers. Plastics. Used in the synthesis of Disperse Orange 37 (D493490).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501 |
| Safety Statements | 24/25 |
| RTECS | BY0100000 |
| HS Code | 2926.90.4801 |






![N-[3-[(2-Cyanoethyl)(2-hydroxyethyl)amino]-4-methoxyphenyl]acetamide](https://img.chemicalbook.com/CAS/GIF/22588-78-9.gif)