A2375612
4′-Chloroacetoacetanilide , 98% , 101-92-8
CAS NO.：101-92-8
Empirical Formula: C10H10ClNO2
Molecular Weight: 211.64
MDL number: MFCD00000613
EINECS: 202-989-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB40.80 | In Stock |
|
| 100G | RMB47.20 | In Stock |
|
| 500G | RMB126.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 131-134 °C (lit.) |
| Boiling point: | 303°C (rough estimate) |
| Density | 1.44 g/cm3 (20℃) |
| vapor density | 7.31 |
| refractive index | 1.5388 (estimate) |
| Flash point: | 350°F(COC) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | acetone: soluble25mg/mL, clear, colorless to light yellow |
| form | Crystalline Powder |
| pka | 11.00±0.46(Predicted) |
| color | Off-white to beige |
| CAS DataBase Reference | 101-92-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Butanamide, N-(4-chlorophenyl)-3-oxo-(101-92-8) |
| EPA Substance Registry System | Butanamide, N-(4-chlorophenyl)-3-oxo- (101-92-8) |
Description and Uses
4′-Chloroacetoacetanilide was used in recombinant androgen receptor competitive binding assay for analysis of natural, synthetic and environmental chemicals.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Safety Statements | 24/25 |
| WGK Germany | 1 |
| RTECS | AK4375000 |
| HS Code | 29242990 |
| Hazardous Substances Data | 101-92-8(Hazardous Substances Data) |
| Toxicity | ipr-mus LDLo 500 mg/kg CBCCT* 4,225,52 |
