A2377712
1-Chloro-4-ethynylbenzene , 98% , 873-73-4
Synonym(s):
(4-Chlorophenyl)acetylene
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB39.20 | In Stock |
|
| 1G | RMB66.40 | In Stock |
|
| 5G | RMB160.00 | In Stock |
|
| 25g | RMB528.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45-47 °C(lit.) |
| Boiling point: | 79-82 °C (23 mmHg) |
| Density | 1.24 g/cm3(Temp: 50 °C) |
| Flash point: | 10 °C |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Acetone, Chloroform (Slightly), Dichloromethane, DMF, DMSO, Ethanol, Ethyl Acetate) |
| form | Crystalline Mass |
| color | Yellow to pale brown |
| Water Solubility | Insoluble in water. Soluble in acetone, chloroform, dichloromethane, DMF, DMSO, ethanol, ethyl acetate, hexane, methanol,THF and toluene. |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C8H5Cl/c1-2-7-3-5-8(9)6-4-7/h1,3-6H |
| InChIKey | LFZJRTMTKGYJRS-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(C#C)C=C1 |
| CAS DataBase Reference | 873-73-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-chloro-4-ethynyl-(873-73-4) |
Description and Uses
4-Chlorophenylacetylene is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H228-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | F,Xi |
| Risk Statements | 36/37/38-11 |
| Safety Statements | 16-26-36-37/39 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | FLAMMABLE |
| HazardClass | 4.1 |
| PackingGroup | Ⅱ |
| HS Code | 29039990 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Flam. Sol. 1 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 1.0 Kg (2.2 lbs) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







