A2378112
Chloro[1,3-bis(2,6-diisopropylphenyl)imidazol-2-ylidene]copp , 98% , 578743-87-0
Synonym(s):
[(iPr)CuCl];[1,3-Bis(2,6-diisopropylphenyl)imidazol-2-ylidene]copper(I) chloride
CAS NO.:578743-87-0
Empirical Formula: C27H36ClCuN2*-
Molecular Weight: 487.587
MDL number: MFCD09264276
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB126.40 | In Stock |
|
| 1G | RMB371.20 | In Stock |
|
| 5g | RMB1263.20 | In Stock |
|
| 25g | RMB4679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Powder |
| color | white |
| Sensitive | air sensitive |
| InChI | InChI=1S/C27H36N2.ClH.Cu/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;;/h9-16,18-21H,1-8H3;1H;/q;;+1/p-1 |
| InChIKey | JPUFNIIPFXQOCB-UHFFFAOYSA-M |
| SMILES | N1(C=CN(C2C(=CC=CC=2C(C)C)C(C)C)C1=[Cu]Cl)C1=C(C=CC=C1C(C)C)C(C)C |
Description and Uses
"Use for reduction of olefin and carbonyl, carbene transfer reaction, aziridination of olefins, and methyleneation of aldehydes."
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P261 |
| WGK Germany | 3 |
| HS Code | 2933299090 |

![Chloro[1,3-bis(2,6-diisopropylphenyl)imidazol-2-ylidene]copp](https://img.chemicalbook.com/CAS/GIF/578743-87-0.gif)



