A2392812
Chloro(pentamethylcyclopentadienyl)(cyclooctadiene)ruthenium , 96% , 92390-26-6
Synonym(s):
1,5-Cyclooctadiene, ruthenium complex;Chloro(1,5-cyclooctadiene)(η5-pentamethylcyclopentadienyl)ruthenium;Chloro(1,5-cyclooctadiene)(pentamethylcyclopentadienyl)ruthenium;Cp*RuCl(cod)
CAS NO.:92390-26-6
Empirical Formula: C18H27ClRu5*
Molecular Weight: 379.93
MDL number: MFCD07369035
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB959.20 | In Stock |
|
| 1G | RMB2788.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 143-147℃ |
| storage temp. | -20°C |
| color | brown microxtls |
| Stability: | store cold |
| InChI | InChI=1S/C10H15.C8H12.ClH.Ru/c1-6-7(2)9(4)10(5)8(6)3;1-2-4-6-8-7-5-3-1;;/h1-5H3;1-2,7-8H,3-6H2;1H;/q;;;+1/p-1/b;2-1-,8-7-;; |
| InChIKey | JBVMVFXUVNUNNG-ONEVTFJLSA-M |
| SMILES | [C]1(C)[C](C)[C]([C](C)[C]1C)C.C1CCC=CCCC=1.[Ru]Cl |c:13,17,^1:0,2,4,5,7| |
Description and Uses
Chloro(pentamethylcyclopentadienyl)(cyclooctadiene)ruthenium(II) is a homogeneous catalyst for the formation of carbon-carbon and carbon-heteroatom bonds.
It can be used:
- To catalyze cyclotrimerization of alkynylboronates, propargyl alcohols, and terminal alkynes to form arylboronate, which in turn undergoes palladium(II)-catalyzed carbonylation to form highly substituted phthalides.
- To catalyze C-C coupling of norbornenes and norbornadiene with alkynesto form [2 + 2] cycloadducts.
- In combination with 2-diphenylphosphinoethylamine-potassium tertiary butoxide to form a ternary catalyst system that can catalyze fast racemization of chiral non-racemic sec-alcohols.
- To synthesize new organoruthenium complexes with phosphorus-based ligands such as bis(phosphino)amines.
- To catalyze the addition of organic disulfides to alkenes leading to vic-dithioethers.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Danger |
| Hazard statements | H261 |
| Precautionary statements | P231+P232-P422 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F |
| Risk Statements | 20/21/22-14/15 |
| Safety Statements | 22-36/37/39-43 |
| RIDADR | UN 3395 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 4.3 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Water-react 2 |



![Chloro[1,3-bis(2,6-diisopropylphenyl)imidazol-2-ylidene]copp](https://img.chemicalbook.com/CAS/GIF/578743-87-0.gif)


