A2388612
2-Chloro-5-(trifluoromethyl)pyridine , 98% , 52334-81-3
CAS NO.:52334-81-3
Empirical Formula: C6H3ClF3N
Molecular Weight: 181.54
MDL number: MFCD00042225
EINECS: 257-856-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB57.60 | In Stock |
|
| 100G | RMB196.00 | In Stock |
|
| 500g | RMB868.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 32-34 °C(lit.) |
| Boiling point: | 152 °C |
| Density | 1.417 g/mL at 25 °C(lit.) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | -2.57±0.10(Predicted) |
| form | Crystalline Low Melting Solid |
| Specific Gravity | 1.417 |
| color | White to yellow |
| BRN | 3649688 |
| InChI | InChI=1S/C6H3ClF3N/c7-5-2-1-4(3-11-5)6(8,9)10/h1-3H |
| InChIKey | JFZJMSDDOOAOIV-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(C(F)(F)F)C=C1 |
| CAS DataBase Reference | 52334-81-3(CAS DataBase Reference) |
| EPA Substance Registry System | Pyridine, 2-chloro-5-(trifluoromethyl)- (52334-81-3) |
Description and Uses
2-Chloro-5-(trifluoromethyl)pyridine may be employed as model substrate to investigate the regioexhaustive functionalization.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn,T,F |
| Risk Statements | 36/37/38-20/21/22-25-11 |
| Safety Statements | 26-37/39-36/37/39-45-22-16 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | US7530000 |
| Hazard Note | Irritant |
| TSCA | T |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






