A2401612
2-Chloro-4-methoxypyridine , 98% , 17228-69-2
CAS NO.:17228-69-2
Empirical Formula: C6H6ClNO
Molecular Weight: 143.57
MDL number: MFCD02093951
EINECS: 625-435-9
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB28.00 | In Stock |
|
| 1G | RMB67.20 | In Stock |
|
| 5G | RMB240.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 224-225 °C (lit.) |
| Density | 1.258 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in alcohol. |
| form | Liquid |
| pka | 2.25±0.10(Predicted) |
| Specific Gravity | 1.258 |
| color | Colorless to pale yellow |
| BRN | 1423379 |
| InChI | InChI=1S/C6H6ClNO/c1-9-5-2-3-8-6(7)4-5/h2-4H,1H3 |
| InChIKey | PMTPFBWHUOWTNN-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(OC)=C1 |
| CAS DataBase Reference | 17228-69-2(CAS DataBase Reference) |
Description and Uses
2-Chloro-4-methoxypyridine may be used to synthesize:
- 2-(2′,4′-difluorophenyl)-4-methoxypyridine
- (2-chloro-4-methoxypyridin-3-yl)bis-[2-(methylsulfanyl)pyrimidin-4-yl]methanol
- (2-chloro-4-methoxypyridin-3-yl)bis-[2-(methylsulfanyl) pyrimidin-4-yl]methyl acetate
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





