A2405912
2-Chloro-4-nitropyridine , 98% , 23056-36-2
CAS NO.：23056-36-2
Empirical Formula: C5H3ClN2O2
Molecular Weight: 158.54
MDL number: MFCD00661454
EINECS: 627-980-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB49.60 | In Stock |
|
| 25G | RMB192.00 | In Stock |
|
| 100G | RMB588.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 52-56 °C (lit.) |
| Boiling point: | 258.4±20.0 °C(Predicted) |
| Density | 1.489±0.06 g/cm3(Predicted) |
| Flash point: | 223 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | -1.93±0.10(Predicted) |
| form | crystalline powder |
| color | Yellow |
| BRN | 120418 |
| InChI | InChI=1S/C5H3ClN2O2/c6-5-3-4(8(9)10)1-2-7-5/h1-3H |
| InChIKey | LIEPVGBDUYKPLC-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 23056-36-2(CAS DataBase Reference) |
Description and Uses
2-Chloro-4-nitropyridine may be used to synthesize 2-chloro-4-ethoxypyridine and 4-thiophenoxypyridines.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29333990 |
