A2409112
4-Chloro-2-fluorobenzoic acid , 98% , 446-30-0
CAS NO.:446-30-0
Empirical Formula: C7H4ClFO2
Molecular Weight: 174.56
MDL number: MFCD00042468
EINECS: 207-162-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB18.40 | In Stock |
|
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB81.60 | In Stock |
|
| 100G | RMB319.20 | In Stock |
|
| 500g | RMB1559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204-208 °C (lit.) |
| Boiling point: | 274.7±20.0 °C(Predicted) |
| Density | 1.4016 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.04±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | insoluble |
| BRN | 973358 |
| InChI | InChI=1S/C7H4ClFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11) |
| InChIKey | ZLPXBWMVZANJJQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Cl)C=C1F |
| CAS DataBase Reference | 446-30-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Chloro-2-fluorobenzoic acid(446-30-0) |
| EPA Substance Registry System | Benzoic acid, 4-chloro-2-fluoro- (446-30-0) |
Description and Uses
4-Chloro-2-fluorobenzoic acid may be used in the following studies:
- As starting reagent for the synthesis of furosemide.
- Synthesis of 4′-chloro-2′-fluoroacetophenone.
- Synthesis of novel herbicidal isoxazolecarboxamides.
- Preparation of potential liquid crystals.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







