A2410812
2-Chloro-5-fluorobenzaldehyde , 98% , 84194-30-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB95.20 | In Stock |
|
| 25G | RMB276.00 | In Stock |
|
| 100G | RMB755.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 46.5-48°C |
| Boiling point: | 207.2±20.0 °C(Predicted) |
| Density | 1.352±0.06 g/cm3(Predicted) |
| Flash point: | 79° |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| color | Low-melting |
| InChI | InChI=1S/C7H4ClFO/c8-7-2-1-6(9)3-5(7)4-10/h1-4H |
| InChIKey | SOEFVBXUNROUOX-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(F)=CC=C1Cl |
| CAS DataBase Reference | 84194-30-9(CAS DataBase Reference) |
Description and Uses
2-Chloro-5-Fluorobenzaldehyde is a benzaldehyde derivative with chlorine and fluorine atom substituents at the 2 and 5 positions. It is used as a reagent in organic synthesis or chemical reactions and can be used in the preparation of immunomodulators.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2913000090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |




![2,4-Dinitrofluorobenzene [for HPLC Labeling]](https://img.chemicalbook.com/CAS/GIF/70-34-8.gif)
