A2413212
4-Chloro-2-pyridinecarbonitrile , 97% , 19235-89-3
Synonym(s):
2-Cyano-4-chloropyridine;4-Chloro-2-cyanopyridine;4-Chloropicolinonitrile
CAS NO.：19235-89-3
Empirical Formula: C6H3ClN2
Molecular Weight: 138.55
MDL number: MFCD06009833
EINECS: 606-272-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB90.40 | In Stock |
|
| 25G | RMB266.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 81-85 °C |
| Boiling point: | 231.6±20.0 °C(Predicted) |
| Density | 1.33±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | -2.74±0.10(Predicted) |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C6H3ClN2/c7-5-1-2-9-6(3-5)4-8/h1-3H |
| InChIKey | DYEZRXLVZMZHQT-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=CC(Cl)=C1 |
Description and Uses
Substrate used to prepare chiral dialkylaminopyridines bearing a C-2 hydroxyalkyl group via biocatalysis.
Safety
| Symbol(GHS) |    GHS05,GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H319-H301-H318 |
| Precautionary statements | P264-P270-P301+P310+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P405-P501-P280-P301+P310-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29333990 |
