A2436612
3-Chloro-4-cyanopyridine , 96% , 68325-15-5
Synonym(s):
3-Chloro-4-cyanopyridine;3-Chloroisonicotinonitrile
| Pack Size | Price | Stock | Quantity |
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB319.20 | In Stock |
|
| 25g | RMB1444.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 71-73°C |
| Boiling point: | 233.3±20.0 °C(Predicted) |
| Density | 1.33±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Dichloromethane, Ethyl Acetate, Methanol |
| pka | -0.41±0.18(Predicted) |
| form | Solid |
| color | Pale Yellow |
| InChI | InChI=1S/C6H3ClN2/c7-6-4-9-2-1-5(6)3-8/h1-2,4H |
| InChIKey | JLLJPPBGJVCFGG-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(C#N)=C1Cl |
| CAS DataBase Reference | 68325-15-5(CAS DataBase Reference) |
Description and Uses
3-Chloro-4-cyanopyridine (cas# 68325-15-5) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P301+P310-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37 |
| RIDADR | UN3439 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
