A2414012
4-Chloro-3-nitrobenzonitrile , 98% , 939-80-0
CAS NO.：939-80-0
Empirical Formula: C7H3ClN2O2
Molecular Weight: 182.56
MDL number: MFCD00016987
EINECS: 213-364-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.00 | In Stock |
|
| 25G | RMB92.00 | In Stock |
|
| 100G | RMB356.80 | In Stock |
|
| 500g | RMB1580.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-100 °C (lit.) |
| Boiling point: | 284.8±25.0 °C(Predicted) |
| Density | 1.6133 (rough estimate) |
| refractive index | 1.5557 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Slightly soluble in water |
| form | powder to crystal |
| color | White to Light yellow to Green |
| BRN | 1639111 |
| InChI | InChI=1S/C7H3ClN2O2/c8-6-2-1-5(4-9)3-7(6)10(11)12/h1-3H |
| InChIKey | XBLPHYSLHRGMNW-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(Cl)C([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 939-80-0(CAS DataBase Reference) |
Description and Uses
4-Chloro-3-nitrobenzonitrile may be used in the synthesis of 3-nitro-4-thiocyanobenzonitryl.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37 |
| WGK Germany | 2 |
| RTECS | DI3050000 |
| HS Code | 29269090 |
