A2415612
(2S,8aR)-(-)-(Camphorylsulfonyl)oxaziridine , 98% , 104372-31-8
Synonym(s):
(1R)-(−)-(Camphorylsulfonyl)oxaziridine;(1R)-(−)-2,N-Epoxy-exo-10,2-bornanesultam
| Pack Size | Price | Stock | Quantity |
| 1G | RMB64.00 | In Stock |
|
| 5G | RMB212.80 | In Stock |
|
| 10G | RMB383.20 | In Stock |
|
| 25G | RMB912.80 | In Stock |
|
| 100g | RMB2719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-174 °C |
| alpha | -46.6 º (c=2, CHCl3 25 ºC) |
| Boiling point: | 317.6±25.0 °C(Predicted) |
| Density | 1.2486 (rough estimate) |
| refractive index | 1.5060 (estimate) |
| Flash point: | 170℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | -11.75±0.40(Predicted) |
| color | White |
| optical activity | [α]20/D 44°, c = 2.2 in chloroform |
| BRN | 6274369 |
| InChI | InChI=1/C10H15NO3S/c1-8(2)7-3-4-9(8)6-15(12,13)11-10(9,5-7)14-11/h7H,3-6H2,1-2H3/t7-,9-,10?,11?/s3 |
| InChIKey | GBBJBUGPGFNISJ-SENRVMEJNA-N |
| SMILES | C123C[C@@]4([H])CC[C@@]1(CS(=O)(=O)N2O3)C4(C)C |&1:2,6,r| |
| CAS DataBase Reference | 104372-31-8(CAS DataBase Reference) |
Description and Uses
Reactant involved in:
- Asymmetric synthesis of proton pump inhibitors
- Asymmetric synthesis of polyhydroxylated pyrrolidines
- Diastereoselective hydroxylation of chlorophylls a and b enolate anions
Used in impregnated silica nanoparticles for removal of sulfur mustard from wastewater
Used to modify blebbistatin for investigations of myosin inhibitor design
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |





