A2421512
2-Chloro-5-nitroaniline , 98% , 6283-25-6
CAS NO.：6283-25-6
Empirical Formula: C6H5ClN2O2
Molecular Weight: 172.57
MDL number: MFCD00007668
EINECS: 228-498-7
| Pack Size | Price | Stock | Quantity |
| 25G | RMB37.60 | In Stock |
|
| 100G | RMB109.60 | In Stock |
|
| 250g | RMB221.60 | In Stock |
|
| 500G | RMB400.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-120 °C(lit.) |
| Boiling point: | 200°C (rough estimate) |
| Density | 1.5610 (rough estimate) |
| refractive index | 1.5870 (estimate) |
| Flash point: | 191°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 0.60±0.10(Predicted) |
| form | powder to crystal |
| color | Light yellow to Amber to Dark green |
| BRN | 2208878 |
| InChI | InChI=1S/C6H5ClN2O2/c7-5-2-1-4(9(10)11)3-6(5)8/h1-3H,8H2 |
| InChIKey | KWIXNFOTNVKIGM-UHFFFAOYSA-N |
| SMILES | C1(N)=CC([N+]([O-])=O)=CC=C1Cl |
| CAS DataBase Reference | 6283-25-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 2-chloro-5-nitro-(6283-25-6) |
| EPA Substance Registry System | 2-Chloro-5-nitroaniline (6283-25-6) |
Description and Uses
2-Chloro-5-nitroaniline is a chemical reagent used in the synthesis anti-inflammatory 1,1-dioxido propenone derivatives.
Safety
| Symbol(GHS) |     GHS06,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H300-H310-H330-H373-H411-H401-H300+H310+H330-H315-H319 |
| Precautionary statements | P262-P270-P271-P301+P310+P330-P302+P352+P310+P361+P364-P304+P340+P310-P305+P351+P338+P337+P313-P314-P391-P403+P233-P405-P501-P260-P264-P273-P280-P284-P301+P310-P301+P310a-P304+P340-P320-P330-P501a |
| Hazard Codes | T+,N |
| Risk Statements | 26/27/28-33-51/53-50/53 |
| Safety Statements | 28-36/37-45-61-28A-60-13 |
| RIDADR | UN 2237 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | BX1500000 |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29215900 |
| Hazardous Substances Data | 6283-25-6(Hazardous Substances Data) |
