A2711112
5-<WBR>Chloro-<WBR>2,4-<WBR>dinitrotoluene , 97% , 51676-74-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB453.60 | In Stock |
|
| 25g | RMB1556.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87-91 °C (lit.) |
| Boiling point: | 334.0±37.0 °C(Predicted) |
| Density | 1.4054 g/cm3(Temp: 99.2 °C) |
| form | solid |
| BRN | 2506591 |
| InChI | 1S/C7H5ClN2O4/c1-4-2-5(8)7(10(13)14)3-6(4)9(11)12/h2-3H,1H3 |
| InChIKey | KPDPGZNHKMJEFZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)c(cc1[N+]([O-])=O)[N+]([O-])=O |
| CAS DataBase Reference | 51676-74-5(CAS DataBase Reference) |
Description and Uses
5-Chloro-2,4-dinitrotoluene (5CDNT) may be used to synthesize 5-methyl-6-nitrobenzofuroxan.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P280 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 36/37 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |
