A2422012
2-Chlorostyrene , 97%, containing 0.1%Hydroquinone stabilizer , 2039-87-4
Synonym(s):
o -Chlorostyrene;o -Chlorovinylbenzene;1-Chloro-2-ethenylbenzene;1-Chloro-2-vinylbenzene
CAS NO.:2039-87-4
Empirical Formula: C8H7Cl
Molecular Weight: 138.59
MDL number: MFCD00000567
EINECS: 218-026-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB97.60 | In Stock |
|
| 10g | RMB144.80 | In Stock |
|
| 25G | RMB346.40 | In Stock |
|
| 100G | RMB1344.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -63.1 °C |
| Boiling point: | 58-60 °C/7 mmHg (lit.) |
| Density | 1.08 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 138 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Colorless to Almost colorless |
| Water Solubility | Insoluble in water. |
| BRN | 2038863 |
| Exposure limits | ACGIH: TWA 50 ppm; STEL 75 ppm NIOSH: TWA 50 ppm(285 mg/m3); STEL 75 ppm(428 mg/m3) |
| InChI | InChI=1S/C8H7Cl/c1-2-7-5-3-4-6-8(7)9/h2-6H,1H2 |
| InChIKey | ISRGONDNXBCDBM-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=CC=C1C=C |
| CAS DataBase Reference | 2039-87-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Chlorostyrene(2039-87-4) |
| EPA Substance Registry System | o-Chlorostyrene (2039-87-4) |
Description and Uses
2-Chlorostyrene is an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS08,GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H332-H350-H315-H319-H227-H335 |
| Precautionary statements | P210-P233-P240-P241+P242+P243-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501-P280g-P305+P351+P338-P201-P261-P304+P340+P312-P308+P313-P403+P235 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,Xi |
| Risk Statements | 45-20/22-36/37/38 |
| Safety Statements | 53-23-36/37/39-45-37/39-26-36 |
| RIDADR | UN 1993 3/PG 3 |
| OEB | A |
| OEL | TWA: 50 ppm (285 mg/m3), STEL: 75 ppm (428 mg/m3) |
| WGK Germany | 3 |
| RTECS | WL4160000 |
| Hazard Note | Harmful |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Inhalation Aquatic Chronic 3 Carc. 1B Flam. Liq. 3 |
| Hazardous Substances Data | 2039-87-4(Hazardous Substances Data) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








