A2422112
7-Chloro-6-nitro-4-hydroxyquinazoline , 98% , 53449-14-2
Synonym(s):
7-Chloro-4-hydroxy-6-nitroquinazoline
CAS NO.：53449-14-2
Empirical Formula: C8H4ClN3O3
Molecular Weight: 225.59
MDL number: MFCD09388771
EINECS: 678-360-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB27.20 | In Stock |
|
| 5G | RMB75.20 | In Stock |
|
| 25G | RMB312.00 | In Stock |
|
| 100G | RMB1127.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 314-319℃ |
| Boiling point: | 427.8±55.0 °C(Predicted) |
| Density | 1.79±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | slightly sol. in Dimethylformamide |
| form | powder to crystal |
| pka | -2.49±0.20(Predicted) |
| color | White to Light yellow to Dark green |
| InChI | InChI=1S/C8H4ClN3O3/c9-5-2-6-4(1-7(5)12(14)15)8(13)11-3-10-6/h1-3H,(H,10,11,13) |
| InChIKey | URDYTQYZXZKBQT-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C([N+]([O-])=O)C(Cl)=C2)C(=O)NC=1 |
| CAS DataBase Reference | 53449-14-2 |
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HS Code | 2933599590 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
