BD0393232
6-Nitroquinazolin-4(3H)-one , 95% , 6943-17-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB28.80 | In Stock |
|
| 250mg | RMB60.00 | In Stock |
|
| 1g | RMB149.60 | In Stock |
|
| 5g | RMB476.00 | In Stock |
|
| 10g | RMB769.60 | In Stock |
|
| 25g | RMB1548.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 286-287 °C |
| Boiling point: | 407.0±47.0 °C(Predicted) |
| Density | 1+-.0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | -1.01±0.20(Predicted) |
| color | Yellow |
| InChI | InChI=1S/C8H5N3O3/c12-8-6-3-5(11(13)14)1-2-7(6)9-4-10-8/h1-4H,(H,9,10,12) |
| InChIKey | MOBNCKURXDGQCB-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C([N+]([O-])=O)C=C2)C(=O)NC=1 |
Description and Uses
Intermediate in the preparation of anticancer agents and enzyme inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315-H302 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P-P264-P270-P301+P312-P330-P501 |
| HazardClass | IRRITANT |






