A2432212
1-Chloro-4-fluorobenzene , 98% , 352-33-0
CAS NO.:352-33-0
Empirical Formula: C6H4ClF
Molecular Weight: 130.55
MDL number: MFCD00000603
EINECS: 206-521-1
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -21.5 °C |
| Boiling point: | 129-130 °C(lit.) |
| Density | 1.226 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 85 °F |
| storage temp. | Flammables area |
| solubility | Difficult to mix. |
| form | Liquid |
| Specific Gravity | 1.226 |
| color | Clear colorless to slightly yellow |
| BRN | 1904542 |
| InChI | InChI=1S/C6H4ClF/c7-5-1-3-6(8)4-2-5/h1-4H |
| InChIKey | RJCGZNCCVKIBHO-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(F)C=C1 |
| CAS DataBase Reference | 352-33-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-chloro-4-fluoro-(352-33-0) |
| EPA Substance Registry System | Benzene, 1-chloro-4-fluoro- (352-33-0) |
Description and Uses
1-Chloro-4-fluorobenzeneis used as a primary and secondary intermediates, organic synthesis. And it is also used to prepare (4'-fluoro-biphenyl-4-yl)-methyl ether by using reagents NaH, Ni (OAc)2, 2,2 '-bipyridyl, KI and solvents benzene, tetrahydrofuran at temperature of 63°C.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F,T |
| Risk Statements | 10-36/37/38-39/23/24/25-23/24/25-11 |
| Safety Statements | 16-26-36-37/39-45-36/37-7 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable/Irritant |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







