A2432412
2-Chloro-4-fluoro-1-nitrobenzene , 98% , 2106-50-5
CAS NO.：2106-50-5
Empirical Formula: C6H3ClFNO2
Molecular Weight: 175.54
MDL number: MFCD03412200
EINECS: 218-286-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB26.40 | In Stock |
|
| 5G | RMB76.80 | In Stock |
|
| 25G | RMB285.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34-37°C |
| Boiling point: | 71°C/2.3mmHg(lit.) |
| Density | 1.494±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| form | Solid |
| color | Light Yellow |
| InChI | InChI=1S/C6H3ClFNO2/c7-5-3-4(8)1-2-6(5)9(10)11/h1-3H |
| InChIKey | KQOOFMWRLDRDAX-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=CC=C(F)C=C1Cl |
| CAS DataBase Reference | 2106-50-5(CAS DataBase Reference) |
Description and Uses
2-Chloro-4-fluoronitrobenzene is used in the synthesis of active pharmaceutical ingredients (APIs), particularly benzothiazole derivatives.
Safety
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H302-H311 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501-P280h-P305+P351+P338-P309-P310 |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38-36/38-21/22 |
| Safety Statements | 26-36/37/39-36/37 |
| RIDADR | 2811 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29049090 |
