A2440912
2-Chloro-4-methyl-3-nitropyridine , 98% , 23056-39-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB68.00 | In Stock |
|
| 25G | RMB199.20 | In Stock |
|
| 100G | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51-53 °C (lit.) |
| Boiling point: | 279.6±35.0 °C(Predicted) |
| Density | 1.406±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | -1.80±0.10(Predicted) |
| form | Powder |
| color | Yellow to beige |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C6H5ClN2O2/c1-4-2-3-8-6(7)5(4)9(10)11/h2-3H,1H3 |
| InChIKey | JHARVUVBTAAPLA-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(C)=C1[N+]([O-])=O |
| CAS DataBase Reference | 23056-39-5(CAS DataBase Reference) |
Description and Uses
2-Chloro-4-methyl-3-nitropyridine is a cyclopropyldipyridodiazepinone derivative for use as non-nucleoside reverse transcriptase inhibitors.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H302-H312-H331 |
| Precautionary statements | P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P304+P340-P405-P501a |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-21/22 |
| Safety Statements | 26-37/39-36/37/39-36 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






