A2450612
3-Chloro-2-fluoro-5-(trifluoromethyl)pyridine , 98% , 72537-17-8
CAS NO.:72537-17-8
Empirical Formula: C6H2ClF4N
Molecular Weight: 199.53
MDL number: MFCD00191918
EINECS: 625-955-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB95.20 | In Stock |
|
| 25G | RMB226.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 16-20 °C (lit.) |
| Boiling point: | 50-55 °C/11 mmHg (lit.) |
| Density | 1.524 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 125 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Liquid |
| color | Colorless |
| InChI | InChI=1S/C6H2ClF4N/c7-4-1-3(6(9,10)11)2-12-5(4)8/h1-2H |
| InChIKey | GDSROTVTTLUHCO-UHFFFAOYSA-N |
| SMILES | C1(F)=NC=C(C(F)(F)F)C=C1Cl |
| CAS DataBase Reference | 72537-17-8(CAS DataBase Reference) |
Description and Uses
3-Chloro-2-fluoro-5-(trifluoromethyl)pyridine, a halogenated pyridine derivative, is a fluorinated building block. It participates in the synthesis of 2,3-difluoro-5-(trifluoromethyl)pyridine.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |








