A3728112
2,3-difluoro-5-(trifluoromethyl)pyridine , 97% , 89402-42-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB85.52 | In Stock |
|
| 5g | RMB189.60 | In Stock |
|
| 25g | RMB336.00 | In Stock |
|
| 10g | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -20°C |
| Boiling point: | 104°C |
| Density | 1,47 g/cm3 |
| refractive index | 1.3860-1.3900 |
| Flash point: | 28°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| pka | -5.28±0.20(Predicted) |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C6H2F5N/c7-4-1-3(6(9,10)11)2-12-5(4)8/h1-2H |
| InChIKey | XIFCGIKPAAZFFS-UHFFFAOYSA-N |
| SMILES | C1(F)=NC=C(C(F)(F)F)C=C1F |
| CAS DataBase Reference | 89402-42-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,T |
| Risk Statements | 10-36-25 |
| Safety Statements | 16-45-26 |
| RIDADR | 1993 |
| WGK Germany | WGK 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Flam. Liq. 3 |







