A2451612
2-Chloro-N-methoxy-N-methylacetamide , 98% , 67442-07-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB127.20 | In Stock |
|
| 100G | RMB488.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 39-41 °C(lit.) |
| Boiling point: | 94-95 °C |
| Density | 1.178±0.06 g/cm3 (20 ºC 760 Torr) |
| Flash point: | 220 °F |
| storage temp. | 2-8°C |
| form | Crystals |
| color | White to light yellow |
| Water Solubility | Insoluble in water. |
| BRN | 1924015 |
| InChI | InChI=1S/C4H8ClNO2/c1-6(8-2)4(7)3-5/h3H2,1-2H3 |
| InChIKey | SCOJKGRNQDKFRP-UHFFFAOYSA-N |
| SMILES | C(N(OC)C)(=O)CCl |
| CAS DataBase Reference | 67442-07-3(CAS DataBase Reference) |
Description and Uses
2-Chloro-N-methoxy-N-methylacetamide is used in the preparation of 2-heptyl-3-hydroxy-4(1H)-quinolone (Pseudomonas quinolone signal or PQS) and structurally related 2-alkyl-4-quinolones having biological activity, 2-(benzo[d]thiazol-2-ylsulfonyl)-N-methoxy-N-methylacetamide and α-chloro-ketone, starting reagent for the one-pot synthesis of 2-heptyl-3-hydroxyl-4(1H)-quinolone (PQS), signaling molecule in the quorum sensing of Pseudomonas aeruginosa.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 23-26-27-28-37/39 |
| WGK Germany | 3 |
| HS Code | 29241900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |






