A2491612
4-chloro-2-nitrobenzylalcohol , 98% , 22996-18-5
CAS NO.：22996-18-5
Empirical Formula: C7H6ClNO3
Molecular Weight: 187.58
MDL number: MFCD00007217
EINECS: 245-374-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB104.80 | In Stock |
|
| 5G | RMB452.00 | In Stock |
|
| 25G | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-92 °C (lit.) |
| Boiling point: | 306.1±27.0 °C(Predicted) |
| Density | 1.476±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 13.57±0.10(Predicted) |
| form | solid |
| color | Beige |
| InChI | 1S/C7H6ClNO3/c8-6-2-1-5(4-10)7(3-6)9(11)12/h1-3,10H,4H2 |
| InChIKey | OAHGNOHGHOTZQU-UHFFFAOYSA-N |
| SMILES | OCc1ccc(Cl)cc1[N+]([O-])=O |
| CAS DataBase Reference | 22996-18-5(CAS DataBase Reference) |
Description and Uses
4-Chloro-2-nitrobenzyl alcohol undergoes oxidation in the presence of pyridinium chlorochromate in dichloromethane to yield 4-chloro-2-nitrobenzaldehyde.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2906290090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
