A2497412
2-Chloro-6-methylquinoline-3-carboxaldehyde , 96% , 73568-27-1
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB31.20 | In Stock |
|
| 1g | RMB76.80 | In Stock |
|
| 5G | RMB286.40 | In Stock |
|
| 25G | RMB1054.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120-125 °C (lit.) |
| Boiling point: | 350.8±37.0 °C(Predicted) |
| Density | 1.312±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | -1.11±0.50(Predicted) |
| color | Light orange to Yellow to Green |
| InChI | 1S/C11H8ClNO/c1-7-2-3-10-8(4-7)5-9(6-14)11(12)13-10/h2-6H,1H3 |
| InChIKey | FSLNYYZJXMGKHK-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1cc2cc(C)ccc2nc1Cl |
| CAS DataBase Reference | 73568-27-1(CAS DataBase Reference) |
Description and Uses
2-Chloro-6-methylquinoline-3-carboxaldehyde (cas# 73568-27-1) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2933.49.7000 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




