A2502812
Cinoxacin , ≥99% , 28657-80-9
Synonym(s):
1-Ethyl-1,4-dihydro-4-oxo-[1,3]dioxolo[4,5-g]cinnoline-3-carboxylic acid
CAS NO.:28657-80-9
Empirical Formula: C12H10N2O5
Molecular Weight: 262.22
MDL number: MFCD00056776
EINECS: 249-133-8
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB87.20 | In Stock |
|
| 250MG | RMB255.20 | In Stock |
|
| 1G | RMB607.20 | In Stock |
|
| 5G | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 261-262° (dec) |
| Boiling point: | 405.47°C (rough estimate) |
| Density | 1.3545 (rough estimate) |
| refractive index | 1.6660 (estimate) |
| storage temp. | 2-8°C |
| solubility | 1 M NaOH: soluble50mg/mL |
| pka | pKa 5.38(H2O t=25.0 I=0.025) (Uncertain) |
| form | solid |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChI | 1S/C12H10N2O5/c1-2-14-7-4-9-8(18-5-19-9)3-6(7)11(15)10(13-14)12(16)17/h3-4H,2,5H2,1H3,(H,16,17) |
| InChIKey | VDUWPHTZYNWKRN-UHFFFAOYSA-N |
| SMILES | CCN1N=C(C(O)=O)C(=O)c2cc3OCOc3cc12 |
| CAS DataBase Reference | 28657-80-9(CAS DataBase Reference) |
Description and Uses
Cinoxacin is an antibacterial quinolone previously known for its use in the treatment of urinary tract infections.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 2 |
| RTECS | JI4640000 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 in rats (mg/kg): 4160 orally; 900 i.v. (Narama) |






