A2504512
2-Chlorophenethyl alcohol , ≥98.0%(GC) , 19819-95-5
CAS NO.:19819-95-5
Empirical Formula: C8H9ClO
Molecular Weight: 156.61
MDL number: MFCD00002888
EINECS: 243-348-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.80 | In Stock |
|
| 5G | RMB120.80 | In Stock |
|
| 25G | RMB563.20 | In Stock |
|
| 100G | RMB1942.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 84-85 °C/3 mmHg (lit.) |
| Density | 1.19 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| pka | 14.72±0.10(Predicted) |
| Specific Gravity | 1.19 |
| color | Clear colorless |
| InChI | InChI=1S/C8H9ClO/c9-8-4-2-1-3-7(8)5-6-10/h1-4,10H,5-6H2 |
| InChIKey | IWNHTCBFRSCBQK-UHFFFAOYSA-N |
| SMILES | C1(CCO)=CC=CC=C1Cl |
Description and Uses
2-Chlorophenethyl alcohol may be used in the chemical synthesis of amines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29052900 |
| Storage Class | 10 - Combustible liquids |







